![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| IO Commodity classification structure and concordances, 2009.xls | 2013-05-23 12:40 | 434K | |
| IO Final demand classification structure and concordances, 2009.xls | 2013-05-23 12:40 | 313K | |
| IO Industry classification structure and concordances, 2009.xls | 2013-05-23 12:40 | 253K | |
| Modernisation des tableaux d'entrées-sorties, 2009.pdf | 2013-05-23 12:40 | 227K | |
| Modernization of the IO tables, 2009.pdf | 2013-05-23 12:40 | 206K | |