![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2009/ | 2013-08-28 12:55 | - | |
| 2010/ | 2014-10-31 14:16 | - | |
| 2011/ | 2015-09-09 13:36 | - | |
| IO Commodity classification structure and concordances, 2009.xls | 2013-05-23 13:06 | 434K | |
| IO Final demand classification structure and concordances, 2009.xls | 2013-05-23 13:06 | 313K | |
| Modernization of the IO tables, 2009.pdf | 2013-04-25 08:59 | 206K | |
| README.txt | 2009-11-02 14:01 | 5.2K | |
| superseded/ | 2013-05-22 13:39 | - | |
| tables/ | 2013-05-22 13:39 | - | |